C15H22N4O — CID 107488661
2,6-dimethyl-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]pyridine-3-carboxamide (PubChem CID 107488661) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 2,6-dimethyl-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]pyridine-3-carboxamide.
| Compound Name | 2,6-dimethyl-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107488661 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2,6-dimethyl-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]pyridine-3-carboxamide |
| SMILES | Cc1cc(NCCC2=CCNCC2)c(C(N)=O)c(C)n1 |
| InChI | InChI=1S/C15H22N4O/c1-10-9-13(14(15(16)20)11(2)19-10)18-8-5-12-3-6-17-7-4-12/h3,9,17H,4-8H2,1-2H3,(H2,16,20)(H,18,19) |
| InChIKey | UAIVTPVDVAFDBD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|