C16H20N4O — CID 81035906
4-[2-(4-aminophenyl)ethylamino]-2,6-dimethylpyridine-3-carboxamide (PubChem CID 81035906) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-[2-(4-aminophenyl)ethylamino]-2,6-dimethylpyridine-3-carboxamide.
| Compound Name | 4-[2-(4-aminophenyl)ethylamino]-2,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 81035906 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 4-[2-(4-aminophenyl)ethylamino]-2,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1cc(NCCc2ccc(N)cc2)c(C(N)=O)c(C)n1 |
| InChI | InChI=1S/C16H20N4O/c1-10-9-14(15(16(18)21)11(2)20-10)19-8-7-12-3-5-13(17)6-4-12/h3-6,9H,7-8,17H2,1-2H3,(H2,18,21)(H,19,20) |
| InChIKey | XFIKEDJEPFGSRK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|