C12H19N5 — CID 107489073
5,6-dimethyl-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]-1,2,4-triazin-3-amine (PubChem CID 107489073) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 5,6-dimethyl-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]-1,2,4-triazin-3-amine.
| Compound Name | 5,6-dimethyl-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 107489073 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 5,6-dimethyl-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]-1,2,4-triazin-3-amine |
| SMILES | Cc1nnc(NCCC2=CCNCC2)nc1C |
| InChI | InChI=1S/C12H19N5/c1-9-10(2)16-17-12(15-9)14-8-5-11-3-6-13-7-4-11/h3,13H,4-8H2,1-2H3,(H,14,15,17) |
| InChIKey | FOHKKBLKPGHJPB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|