C12H19N5O2 — CID 107489215
1,3-dimethyl-4-nitro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]pyrazol-5-amine (PubChem CID 107489215) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 1,3-dimethyl-4-nitro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]pyrazol-5-amine.
| Compound Name | 1,3-dimethyl-4-nitro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 107489215 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 1,3-dimethyl-4-nitro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]pyrazol-5-amine |
| SMILES | Cc1nn(C)c(NCCC2=CCNCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H19N5O2/c1-9-11(17(18)19)12(16(2)15-9)14-8-5-10-3-6-13-7-4-10/h3,13-14H,4-8H2,1-2H3 |
| InChIKey | QBRYPIDVKKTCSM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|