C13H19N7O2 — CID 86788846
1,3-dimethyl-4-nitro-N-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrazol-5-amine (PubChem CID 86788846) has the molecular formula C13H19N7O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 1,3-dimethyl-4-nitro-N-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrazol-5-amine.
| Compound Name | 1,3-dimethyl-4-nitro-N-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 86788846 |
| Molecular Formula | C13H19N7O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 1,3-dimethyl-4-nitro-N-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrazol-5-amine |
| SMILES | Cc1nn(C)c(NCCc2nnc3n2CCCC3)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N7O2/c1-9-12(20(21)22)13(18(2)17-9)14-7-6-11-16-15-10-5-3-4-8-19(10)11/h14H,3-8H2,1-2H3 |
| InChIKey | UYRFZDQSEGPMNZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|