C18H26N2O5S — CID 99978528
3-[2-(cyclohexen-1-yl)ethylsulfamoyl]-4-(2-methoxyethylamino)benzoic acid (PubChem CID 99978528) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethylsulfamoyl]-4-(2-methoxyethylamino)benzoic acid.
| Compound Name | 3-[2-(cyclohexen-1-yl)ethylsulfamoyl]-4-(2-methoxyethylamino)benzoic acid |
|---|---|
| PubChem CID | 99978528 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethylsulfamoyl]-4-(2-methoxyethylamino)benzoic acid |
| SMILES | COCCNc1ccc(C(=O)O)cc1S(=O)(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C18H26N2O5S/c1-25-12-11-19-16-8-7-15(18(21)22)13-17(16)26(23,24)20-10-9-14-5-3-2-4-6-14/h5,7-8,13,19-20H,2-4,6,9-12H2,1H3,(H,21,22) |
| InChIKey | QTXNCEYQYWJDPH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|