C15H17F2NO2 — CID 79838078
4-[2-(cyclohexen-1-yl)ethylamino]-2,3-difluorobenzoic acid (PubChem CID 79838078) has the molecular formula C15H17F2NO2 and a molecular weight of 281.30 g/mol. Its IUPAC name is 4-[2-(cyclohexen-1-yl)ethylamino]-2,3-difluorobenzoic acid.
| Compound Name | 4-[2-(cyclohexen-1-yl)ethylamino]-2,3-difluorobenzoic acid |
|---|---|
| PubChem CID | 79838078 |
| Molecular Formula | C15H17F2NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 4-[2-(cyclohexen-1-yl)ethylamino]-2,3-difluorobenzoic acid |
| SMILES | O=C(O)c1ccc(NCCC2=CCCCC2)c(F)c1F |
| InChI | InChI=1S/C15H17F2NO2/c16-13-11(15(19)20)6-7-12(14(13)17)18-9-8-10-4-2-1-3-5-10/h4,6-7,18H,1-3,5,8-9H2,(H,19,20) |
| InChIKey | FJPVOQZZUJUWMN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|