C17H15F4NO — CID 113197454
2-(4-fluorophenyl)-2-methyl-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 113197454) has the molecular formula C17H15F4NO and a molecular weight of 325.31 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2-methyl-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-(4-fluorophenyl)-2-methyl-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 113197454 |
| Molecular Formula | C17H15F4NO |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-(4-fluorophenyl)-2-methyl-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C)(C(=O)Nc1ccccc1C(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15F4NO/c1-16(2,11-7-9-12(18)10-8-11)15(23)22-14-6-4-3-5-13(14)17(19,20)21/h3-10H,1-2H3,(H,22,23) |
| InChIKey | VQVIJVFSIIVAPN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |