C21H25N3O3 — CID 108968225
N-(4-acetamidophenyl)-N'-(2-ethylphenyl)-2,2-dimethylpropanediamide (PubChem CID 108968225) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-N'-(2-ethylphenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(4-acetamidophenyl)-N'-(2-ethylphenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108968225 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-(4-acetamidophenyl)-N'-(2-ethylphenyl)-2,2-dimethylpropanediamide |
| SMILES | CCc1ccccc1NC(=O)C(C)(C)C(=O)Nc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C21H25N3O3/c1-5-15-8-6-7-9-18(15)24-20(27)21(3,4)19(26)23-17-12-10-16(11-13-17)22-14(2)25/h6-13H,5H2,1-4H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | KUPMCBLGPBCIBG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|