C22H28N2O2 — CID 108963266
N-benzyl-N-ethyl-N'-(2-ethylphenyl)-2,2-dimethylpropanediamide (PubChem CID 108963266) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-benzyl-N-ethyl-N'-(2-ethylphenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-benzyl-N-ethyl-N'-(2-ethylphenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108963266 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-benzyl-N-ethyl-N'-(2-ethylphenyl)-2,2-dimethylpropanediamide |
| SMILES | CCc1ccccc1NC(=O)C(C)(C)C(=O)N(CC)Cc1ccccc1 |
| InChI | InChI=1S/C22H28N2O2/c1-5-18-14-10-11-15-19(18)23-20(25)22(3,4)21(26)24(6-2)16-17-12-8-7-9-13-17/h7-15H,5-6,16H2,1-4H3,(H,23,25) |
| InChIKey | AWJJCXYSVBOGFF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|