C21H23F3N2O2 — CID 108963299
N-benzyl-N-ethyl-2,2-dimethyl-N'-[2-(trifluoromethyl)phenyl]propanediamide (PubChem CID 108963299) has the molecular formula C21H23F3N2O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2,2-dimethyl-N'-[2-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N-benzyl-N-ethyl-2,2-dimethyl-N'-[2-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 108963299 |
| Molecular Formula | C21H23F3N2O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-benzyl-N-ethyl-2,2-dimethyl-N'-[2-(trifluoromethyl)phenyl]propanediamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C(C)(C)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H23F3N2O2/c1-4-26(14-15-10-6-5-7-11-15)19(28)20(2,3)18(27)25-17-13-9-8-12-16(17)21(22,23)24/h5-13H,4,14H2,1-3H3,(H,25,27) |
| InChIKey | WLWGHXJIUHOWNQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|