C15H20Cl2N2O2 — CID 108965784
N-(2,3-dichlorophenyl)-N',N'-diethyl-2,2-dimethylpropanediamide (PubChem CID 108965784) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-N',N'-diethyl-2,2-dimethylpropanediamide.
| Compound Name | N-(2,3-dichlorophenyl)-N',N'-diethyl-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108965784 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-(2,3-dichlorophenyl)-N',N'-diethyl-2,2-dimethylpropanediamide |
| SMILES | CCN(CC)C(=O)C(C)(C)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H20Cl2N2O2/c1-5-19(6-2)14(21)15(3,4)13(20)18-11-9-7-8-10(16)12(11)17/h7-9H,5-6H2,1-4H3,(H,18,20) |
| InChIKey | PFMHUOVFEBLMQH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|