C19H29N3S — CID 7402504
1-[(1S,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-methylpropyl)thiourea (PubChem CID 7402504) has the molecular formula C19H29N3S and a molecular weight of 331.53 g/mol. Its IUPAC name is 1-[(1S,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[(1S,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 7402504 |
| Molecular Formula | C19H29N3S |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 1-[(1S,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-methylpropyl)thiourea |
| SMILES | CC(C)CNC(=S)NC1C[C@H]2CC[C@@H](C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C19H29N3S/c1-14(2)12-20-19(23)21-16-10-17-8-9-18(11-16)22(17)13-15-6-4-3-5-7-15/h3-7,14,16-18H,8-13H2,1-2H3,(H2,20,21,23)/t16?,17-,18+ |
| InChIKey | IYUMUAYXHKXLTB-AYHJJNSGSA-N |
| XLogP | 3.30 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|