C22H26FN3S — CID 3217809
1-[8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-methylphenyl)thiourea (PubChem CID 3217809) has the molecular formula C22H26FN3S and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-[8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-methylphenyl)thiourea.
| Compound Name | 1-[8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 3217809 |
| Molecular Formula | C22H26FN3S |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-[8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-methylphenyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)NC1CC2CCC(C1)N2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H26FN3S/c1-15-4-2-3-5-21(15)25-22(27)24-18-12-19-10-11-20(13-18)26(19)14-16-6-8-17(23)9-7-16/h2-9,18-20H,10-14H2,1H3,(H2,24,25,27) |
| InChIKey | UBWNQAHMFSOMIH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|