C22H27FN3OS+ — CID 7389556
1-[(1R,5S)-8-[(4-fluorophenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl]-3-(4-methoxyphenyl)thiourea (PubChem CID 7389556) has the molecular formula C22H27FN3OS+ and a molecular weight of 400.54 g/mol. Its IUPAC name is 1-[(1R,5S)-8-[(4-fluorophenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[(1R,5S)-8-[(4-fluorophenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 7389556 |
| Molecular Formula | C22H27FN3OS+ |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-[(1R,5S)-8-[(4-fluorophenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NC2C[C@H]3CC[C@@H](C2)[NH+]3Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H26FN3OS/c1-27-21-10-6-17(7-11-21)24-22(28)25-18-12-19-8-9-20(13-18)26(19)14-15-2-4-16(23)5-3-15/h2-7,10-11,18-20H,8-9,12-14H2,1H3,(H2,24,25,28)/p+1/t18?,19-,20+ |
| InChIKey | QIXWATIPOIUSQV-IHWFROFDSA-O |
| XLogP | 2.90 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|