C19H28N3OS+ — CID 50937858
1-(3-methoxyphenyl)-3-[(1R,5R)-9-prop-2-enyl-9-azoniabicyclo[3.3.1]nonan-3-yl]thiourea (PubChem CID 50937858) has the molecular formula C19H28N3OS+ and a molecular weight of 346.52 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-[(1R,5R)-9-prop-2-enyl-9-azoniabicyclo[3.3.1]nonan-3-yl]thiourea.
| Compound Name | 1-(3-methoxyphenyl)-3-[(1R,5R)-9-prop-2-enyl-9-azoniabicyclo[3.3.1]nonan-3-yl]thiourea |
|---|---|
| PubChem CID | 50937858 |
| Molecular Formula | C19H28N3OS+ |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-[(1R,5R)-9-prop-2-enyl-9-azoniabicyclo[3.3.1]nonan-3-yl]thiourea |
| SMILES | C=CC[NH+]1[C@@H]2CCC[C@@H]1CC(NC(=S)Nc1cccc(OC)c1)C2 |
| InChI | InChI=1S/C19H27N3OS/c1-3-10-22-16-7-5-8-17(22)12-15(11-16)21-19(24)20-14-6-4-9-18(13-14)23-2/h3-4,6,9,13,15-17H,1,5,7-8,10-12H2,2H3,(H2,20,21,24)/p+1/t16-,17-/m1/s1 |
| InChIKey | KQTNGTIRGOCNJT-IAGOWNOFSA-O |
| XLogP | 2.14 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|