C19H28N3O+ — CID 7403273
1-(3-methylphenyl)-3-[(1R,5S)-9-prop-2-enyl-9-azoniabicyclo[3.3.1]nonan-3-yl]urea (PubChem CID 7403273) has the molecular formula C19H28N3O+ and a molecular weight of 314.45 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-[(1R,5S)-9-prop-2-enyl-9-azoniabicyclo[3.3.1]nonan-3-yl]urea.
| Compound Name | 1-(3-methylphenyl)-3-[(1R,5S)-9-prop-2-enyl-9-azoniabicyclo[3.3.1]nonan-3-yl]urea |
|---|---|
| PubChem CID | 7403273 |
| Molecular Formula | C19H28N3O+ |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 1-(3-methylphenyl)-3-[(1R,5S)-9-prop-2-enyl-9-azoniabicyclo[3.3.1]nonan-3-yl]urea |
| SMILES | C=CC[NH+]1[C@@H]2CCC[C@H]1CC(NC(=O)Nc1cccc(C)c1)C2 |
| InChI | InChI=1S/C19H27N3O/c1-3-10-22-17-8-5-9-18(22)13-16(12-17)21-19(23)20-15-7-4-6-14(2)11-15/h3-4,6-7,11,16-18H,1,5,8-10,12-13H2,2H3,(H2,20,21,23)/p+1/t16?,17-,18+ |
| InChIKey | CCAUCUKOORTNBN-AYHJJNSGSA-O |
| XLogP | 2.27 |
| TPSA | 45.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|