C18H25FN3O+ — CID 11902309
1-(2-fluorophenyl)-3-[(1R,5S)-9-prop-2-enyl-9-azoniabicyclo[3.3.1]nonan-3-yl]urea (PubChem CID 11902309) has the molecular formula C18H25FN3O+ and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[(1R,5S)-9-prop-2-enyl-9-azoniabicyclo[3.3.1]nonan-3-yl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[(1R,5S)-9-prop-2-enyl-9-azoniabicyclo[3.3.1]nonan-3-yl]urea |
|---|---|
| PubChem CID | 11902309 |
| Molecular Formula | C18H25FN3O+ |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[(1R,5S)-9-prop-2-enyl-9-azoniabicyclo[3.3.1]nonan-3-yl]urea |
| SMILES | C=CC[NH+]1[C@@H]2CCC[C@H]1CC(NC(=O)Nc1ccccc1F)C2 |
| InChI | InChI=1S/C18H24FN3O/c1-2-10-22-14-6-5-7-15(22)12-13(11-14)20-18(23)21-17-9-4-3-8-16(17)19/h2-4,8-9,13-15H,1,5-7,10-12H2,(H2,20,21,23)/p+1/t13?,14-,15+ |
| InChIKey | NMPDIUMGTCTQJT-GOOCMWNKSA-O |
| XLogP | 2.10 |
| TPSA | 45.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|