C23H30N3O+ — CID 50937938
1-[(1R,5R)-9-benzyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-(3-methylphenyl)urea (PubChem CID 50937938) has the molecular formula C23H30N3O+ and a molecular weight of 364.51 g/mol. Its IUPAC name is 1-[(1R,5R)-9-benzyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[(1R,5R)-9-benzyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 50937938 |
| Molecular Formula | C23H30N3O+ |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 1-[(1R,5R)-9-benzyl-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)NC2C[C@H]3CCC[C@H](C2)[NH+]3Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H29N3O/c1-17-7-5-10-19(13-17)24-23(27)25-20-14-21-11-6-12-22(15-20)26(21)16-18-8-3-2-4-9-18/h2-5,7-10,13,20-22H,6,11-12,14-16H2,1H3,(H2,24,25,27)/p+1/t21-,22-/m1/s1 |
| InChIKey | XHPYBPZCNXXYJY-FGZHOGPDSA-O |
| XLogP | 3.29 |
| TPSA | 45.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |