C20H29ClN3S+ — CID 50938087
1-(2-chlorophenyl)-3-[(1R,5R)-9-cyclopentyl-9-azoniabicyclo[3.3.1]nonan-3-yl]thiourea (PubChem CID 50938087) has the molecular formula C20H29ClN3S+ and a molecular weight of 378.99 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[(1R,5R)-9-cyclopentyl-9-azoniabicyclo[3.3.1]nonan-3-yl]thiourea.
| Compound Name | 1-(2-chlorophenyl)-3-[(1R,5R)-9-cyclopentyl-9-azoniabicyclo[3.3.1]nonan-3-yl]thiourea |
|---|---|
| PubChem CID | 50938087 |
| Molecular Formula | C20H29ClN3S+ |
| Molecular Weight | 378.99 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[(1R,5R)-9-cyclopentyl-9-azoniabicyclo[3.3.1]nonan-3-yl]thiourea |
| SMILES | S=C(Nc1ccccc1Cl)NC1C[C@H]2CCC[C@H](C1)[NH+]2C1CCCC1 |
| InChI | InChI=1S/C20H28ClN3S/c21-18-10-3-4-11-19(18)23-20(25)22-14-12-16-8-5-9-17(13-14)24(16)15-6-1-2-7-15/h3-4,10-11,14-17H,1-2,5-9,12-13H2,(H2,22,23,25)/p+1/t16-,17-/m1/s1 |
| InChIKey | XFORQEPWNQNXDF-IAGOWNOFSA-O |
| XLogP | 3.54 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.99 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|