C19H23ClN3OS+ — CID 7402730
1-(2-chlorophenyl)-3-[(1S,5R)-8-(furan-2-ylmethyl)-8-azoniabicyclo[3.2.1]octan-3-yl]thiourea (PubChem CID 7402730) has the molecular formula C19H23ClN3OS+ and a molecular weight of 376.93 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[(1S,5R)-8-(furan-2-ylmethyl)-8-azoniabicyclo[3.2.1]octan-3-yl]thiourea.
| Compound Name | 1-(2-chlorophenyl)-3-[(1S,5R)-8-(furan-2-ylmethyl)-8-azoniabicyclo[3.2.1]octan-3-yl]thiourea |
|---|---|
| PubChem CID | 7402730 |
| Molecular Formula | C19H23ClN3OS+ |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[(1S,5R)-8-(furan-2-ylmethyl)-8-azoniabicyclo[3.2.1]octan-3-yl]thiourea |
| SMILES | S=C(Nc1ccccc1Cl)NC1C[C@H]2CC[C@@H](C1)[NH+]2Cc1ccco1 |
| InChI | InChI=1S/C19H22ClN3OS/c20-17-5-1-2-6-18(17)22-19(25)21-13-10-14-7-8-15(11-13)23(14)12-16-4-3-9-24-16/h1-6,9,13-15H,7-8,10-12H2,(H2,21,22,25)/p+1/t13?,14-,15+ |
| InChIKey | YJIXNYGDOOGZIO-GOOCMWNKSA-O |
| XLogP | 3.00 |
| TPSA | 41.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|