C18H25ClN3S+ — CID 7402927
1-(4-chlorophenyl)-3-[(1S,5R)-9-cyclopropyl-9-azoniabicyclo[3.3.1]nonan-3-yl]thiourea (PubChem CID 7402927) has the molecular formula C18H25ClN3S+ and a molecular weight of 350.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(1S,5R)-9-cyclopropyl-9-azoniabicyclo[3.3.1]nonan-3-yl]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[(1S,5R)-9-cyclopropyl-9-azoniabicyclo[3.3.1]nonan-3-yl]thiourea |
|---|---|
| PubChem CID | 7402927 |
| Molecular Formula | C18H25ClN3S+ |
| Molecular Weight | 350.94 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(1S,5R)-9-cyclopropyl-9-azoniabicyclo[3.3.1]nonan-3-yl]thiourea |
| SMILES | S=C(Nc1ccc(Cl)cc1)NC1C[C@H]2CCC[C@@H](C1)[NH+]2C1CC1 |
| InChI | InChI=1S/C18H24ClN3S/c19-12-4-6-13(7-5-12)20-18(23)21-14-10-16-2-1-3-17(11-14)22(16)15-8-9-15/h4-7,14-17H,1-3,8-11H2,(H2,20,21,23)/p+1/t14?,16-,17+ |
| InChIKey | PYRRMLCJNCDCHF-ZXFUBFMLSA-O |
| XLogP | 2.76 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.94 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|