C15H23ClN3S+ — CID 9096501
1-(4-chlorophenyl)-3-(1-propylpiperidin-1-ium-4-yl)thiourea (PubChem CID 9096501) has the molecular formula C15H23ClN3S+ and a molecular weight of 312.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(1-propylpiperidin-1-ium-4-yl)thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-(1-propylpiperidin-1-ium-4-yl)thiourea |
|---|---|
| PubChem CID | 9096501 |
| Molecular Formula | C15H23ClN3S+ |
| Molecular Weight | 312.89 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(1-propylpiperidin-1-ium-4-yl)thiourea |
| SMILES | CCC[NH+]1CCC(NC(=S)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H22ClN3S/c1-2-9-19-10-7-14(8-11-19)18-15(20)17-13-5-3-12(16)4-6-13/h3-6,14H,2,7-11H2,1H3,(H2,17,18,20)/p+1 |
| InChIKey | DCORWNLKBYYXMJ-UHFFFAOYSA-O |
| XLogP | 2.08 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.89 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|