C11H13IN2S — CID 8679311
1-cyclopropyl-3-(3-iodo-4-methylphenyl)thiourea (PubChem CID 8679311) has the molecular formula C11H13IN2S and a molecular weight of 332.21 g/mol. Its IUPAC name is 1-cyclopropyl-3-(3-iodo-4-methylphenyl)thiourea.
| Compound Name | 1-cyclopropyl-3-(3-iodo-4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 8679311 |
| Molecular Formula | C11H13IN2S |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 1-cyclopropyl-3-(3-iodo-4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NC2CC2)cc1I |
| InChI | InChI=1S/C11H13IN2S/c1-7-2-3-9(6-10(7)12)14-11(15)13-8-4-5-8/h2-3,6,8H,4-5H2,1H3,(H2,13,14,15) |
| InChIKey | VGJAJJDRXKJRKS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|