C12H11N3O2S — CID 116507247
1-cyclopropyl-3-(1,3-dioxoisoindol-5-yl)thiourea (PubChem CID 116507247) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is 1-cyclopropyl-3-(1,3-dioxoisoindol-5-yl)thiourea.
| Compound Name | 1-cyclopropyl-3-(1,3-dioxoisoindol-5-yl)thiourea |
|---|---|
| PubChem CID | 116507247 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 1-cyclopropyl-3-(1,3-dioxoisoindol-5-yl)thiourea |
| SMILES | O=C1NC(=O)c2cc(NC(=S)NC3CC3)ccc21 |
| InChI | InChI=1S/C12H11N3O2S/c16-10-8-4-3-7(5-9(8)11(17)15-10)14-12(18)13-6-1-2-6/h3-6H,1-2H2,(H2,13,14,18)(H,15,16,17) |
| InChIKey | VOSDYKVONMUUMI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|