C11H11N3OS — CID 126210908
1-(2,1-benzoxazol-6-yl)-3-cyclopropylthiourea (PubChem CID 126210908) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 1-(2,1-benzoxazol-6-yl)-3-cyclopropylthiourea.
| Compound Name | 1-(2,1-benzoxazol-6-yl)-3-cyclopropylthiourea |
|---|---|
| PubChem CID | 126210908 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 1-(2,1-benzoxazol-6-yl)-3-cyclopropylthiourea |
| SMILES | S=C(Nc1ccc2conc2c1)NC1CC1 |
| InChI | InChI=1S/C11H11N3OS/c16-11(12-8-3-4-8)13-9-2-1-7-6-15-14-10(7)5-9/h1-2,5-6,8H,3-4H2,(H2,12,13,16) |
| InChIKey | IIKRJLWFBDTHCL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|