C13H15N3S2 — CID 100558761
1-(1,2-benzothiazol-5-yl)-3-cyclopentylthiourea (PubChem CID 100558761) has the molecular formula C13H15N3S2 and a molecular weight of 277.42 g/mol. Its IUPAC name is 1-(1,2-benzothiazol-5-yl)-3-cyclopentylthiourea.
| Compound Name | 1-(1,2-benzothiazol-5-yl)-3-cyclopentylthiourea |
|---|---|
| PubChem CID | 100558761 |
| Molecular Formula | C13H15N3S2 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 1-(1,2-benzothiazol-5-yl)-3-cyclopentylthiourea |
| SMILES | S=C(Nc1ccc2sncc2c1)NC1CCCC1 |
| InChI | InChI=1S/C13H15N3S2/c17-13(15-10-3-1-2-4-10)16-11-5-6-12-9(7-11)8-14-18-12/h5-8,10H,1-4H2,(H2,15,16,17) |
| InChIKey | JFXASKKRRUDLHI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|