C16H21N3OS2 — CID 99793946
1-(1,2-benzothiazol-5-yl)-3-[(1S,3R)-3-ethylsulfanylcyclohexyl]urea (PubChem CID 99793946) has the molecular formula C16H21N3OS2 and a molecular weight of 335.50 g/mol. Its IUPAC name is 1-(1,2-benzothiazol-5-yl)-3-[(1S,3R)-3-ethylsulfanylcyclohexyl]urea.
| Compound Name | 1-(1,2-benzothiazol-5-yl)-3-[(1S,3R)-3-ethylsulfanylcyclohexyl]urea |
|---|---|
| PubChem CID | 99793946 |
| Molecular Formula | C16H21N3OS2 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-(1,2-benzothiazol-5-yl)-3-[(1S,3R)-3-ethylsulfanylcyclohexyl]urea |
| SMILES | CCS[C@@H]1CCC[C@H](NC(=O)Nc2ccc3sncc3c2)C1 |
| InChI | InChI=1S/C16H21N3OS2/c1-2-21-14-5-3-4-12(9-14)18-16(20)19-13-6-7-15-11(8-13)10-17-22-15/h6-8,10,12,14H,2-5,9H2,1H3,(H2,18,19,20)/t12-,14+/m0/s1 |
| InChIKey | ZSSCLGOPEOEKRM-GXTWGEPZSA-N |
| XLogP | 4.48 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |