C19H22ClN3 — CID 139338223
1-(3-chlorophenyl)-2-(4-phenylcyclohexyl)guanidine (PubChem CID 139338223) has the molecular formula C19H22ClN3 and a molecular weight of 327.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(4-phenylcyclohexyl)guanidine.
| Compound Name | 1-(3-chlorophenyl)-2-(4-phenylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 139338223 |
| Molecular Formula | C19H22ClN3 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(4-phenylcyclohexyl)guanidine |
| SMILES | N/C(=N\C1CCC(c2ccccc2)CC1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H22ClN3/c20-16-7-4-8-18(13-16)23-19(21)22-17-11-9-15(10-12-17)14-5-2-1-3-6-14/h1-8,13,15,17H,9-12H2,(H3,21,22,23) |
| InChIKey | FLVXYZWNQQKSJY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|