C11H16N4 — CID 18622151
1-[3-(aminomethyl)phenyl]-2-cyclopropylguanidine (PubChem CID 18622151) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 1-[3-(aminomethyl)phenyl]-2-cyclopropylguanidine.
| Compound Name | 1-[3-(aminomethyl)phenyl]-2-cyclopropylguanidine |
|---|---|
| PubChem CID | 18622151 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 1-[3-(aminomethyl)phenyl]-2-cyclopropylguanidine |
| SMILES | NCc1cccc(N/C(N)=N/C2CC2)c1 |
| InChI | InChI=1S/C11H16N4/c12-7-8-2-1-3-10(6-8)15-11(13)14-9-4-5-9/h1-3,6,9H,4-5,7,12H2,(H3,13,14,15) |
| InChIKey | XYTWDMMDZRDREV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|