C9H9ClF3N3O — CID 142736006
1-(3-chlorophenyl)-3-hydroxy-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 142736006) has the molecular formula C9H9ClF3N3O and a molecular weight of 267.64 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-hydroxy-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-(3-chlorophenyl)-3-hydroxy-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 142736006 |
| Molecular Formula | C9H9ClF3N3O |
| Molecular Weight | 267.64 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 1-(3-chlorophenyl)-3-hydroxy-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | ON/C(=N\CC(F)(F)F)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C9H9ClF3N3O/c10-6-2-1-3-7(4-6)15-8(16-17)14-5-9(11,12)13/h1-4,17H,5H2,(H2,14,15,16) |
| InChIKey | FXURPARRCVKQDW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.64 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|