C14H11ClF3N3O3 — CID 172906489
N-(3-chlorophenyl)-2-[2,3-dioxo-4-(2,2,2-trifluoroethyl)pyrazin-1-yl]acetamide (PubChem CID 172906489) has the molecular formula C14H11ClF3N3O3 and a molecular weight of 361.71 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[2,3-dioxo-4-(2,2,2-trifluoroethyl)pyrazin-1-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[2,3-dioxo-4-(2,2,2-trifluoroethyl)pyrazin-1-yl]acetamide |
|---|---|
| PubChem CID | 172906489 |
| Molecular Formula | C14H11ClF3N3O3 |
| Molecular Weight | 361.71 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | N-(3-chlorophenyl)-2-[2,3-dioxo-4-(2,2,2-trifluoroethyl)pyrazin-1-yl]acetamide |
| SMILES | O=C(Cn1ccn(CC(F)(F)F)c(=O)c1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H11ClF3N3O3/c15-9-2-1-3-10(6-9)19-11(22)7-20-4-5-21(8-14(16,17)18)13(24)12(20)23/h1-6H,7-8H2,(H,19,22) |
| InChIKey | OQMLBZQZTNMYQY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.71 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|