C19H15ClFN3O3 — CID 7286900
2-[4-(3-chloro-4-fluorophenyl)-2,3-dioxopyrazin-1-yl]-N-(3-methylphenyl)acetamide (PubChem CID 7286900) has the molecular formula C19H15ClFN3O3 and a molecular weight of 387.80 g/mol. Its IUPAC name is 2-[4-(3-chloro-4-fluorophenyl)-2,3-dioxopyrazin-1-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[4-(3-chloro-4-fluorophenyl)-2,3-dioxopyrazin-1-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 7286900 |
| Molecular Formula | C19H15ClFN3O3 |
| Molecular Weight | 387.80 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 2-[4-(3-chloro-4-fluorophenyl)-2,3-dioxopyrazin-1-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cn2ccn(-c3ccc(F)c(Cl)c3)c(=O)c2=O)c1 |
| InChI | InChI=1S/C19H15ClFN3O3/c1-12-3-2-4-13(9-12)22-17(25)11-23-7-8-24(19(27)18(23)26)14-5-6-16(21)15(20)10-14/h2-10H,11H2,1H3,(H,22,25) |
| InChIKey | CBJUXTHCKJERRV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.80 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|