C18H13ClFN3O3 — CID 22520370
2-[4-(3-chlorophenyl)-2,3-dioxopyrazin-1-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 22520370) has the molecular formula C18H13ClFN3O3 and a molecular weight of 373.77 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)-2,3-dioxopyrazin-1-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[4-(3-chlorophenyl)-2,3-dioxopyrazin-1-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 22520370 |
| Molecular Formula | C18H13ClFN3O3 |
| Molecular Weight | 373.77 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 2-[4-(3-chlorophenyl)-2,3-dioxopyrazin-1-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(Cn1ccn(-c2cccc(Cl)c2)c(=O)c1=O)Nc1ccccc1F |
| InChI | InChI=1S/C18H13ClFN3O3/c19-12-4-3-5-13(10-12)23-9-8-22(17(25)18(23)26)11-16(24)21-15-7-2-1-6-14(15)20/h1-10H,11H2,(H,21,24) |
| InChIKey | GRQDMZVBWDIVLV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.77 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|