C18H13ClFN3O2S — CID 18592137
2-[4-(4-chlorophenyl)-3-oxopyrazin-2-yl]sulfanyl-N-(2-fluorophenyl)acetamide (PubChem CID 18592137) has the molecular formula C18H13ClFN3O2S and a molecular weight of 389.84 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-3-oxopyrazin-2-yl]sulfanyl-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[4-(4-chlorophenyl)-3-oxopyrazin-2-yl]sulfanyl-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 18592137 |
| Molecular Formula | C18H13ClFN3O2S |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-3-oxopyrazin-2-yl]sulfanyl-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(CSc1nccn(-c2ccc(Cl)cc2)c1=O)Nc1ccccc1F |
| InChI | InChI=1S/C18H13ClFN3O2S/c19-12-5-7-13(8-6-12)23-10-9-21-17(18(23)25)26-11-16(24)22-15-4-2-1-3-14(15)20/h1-10H,11H2,(H,22,24) |
| InChIKey | VLUPXHZDWTYFKX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |