C18H14FN3O2S — CID 20941845
2-[4-(4-fluorophenyl)-3-oxopyrazin-2-yl]sulfanyl-N-phenylacetamide (PubChem CID 20941845) has the molecular formula C18H14FN3O2S and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-3-oxopyrazin-2-yl]sulfanyl-N-phenylacetamide.
| Compound Name | 2-[4-(4-fluorophenyl)-3-oxopyrazin-2-yl]sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 20941845 |
| Molecular Formula | C18H14FN3O2S |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-3-oxopyrazin-2-yl]sulfanyl-N-phenylacetamide |
| SMILES | O=C(CSc1nccn(-c2ccc(F)cc2)c1=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H14FN3O2S/c19-13-6-8-15(9-7-13)22-11-10-20-17(18(22)24)25-12-16(23)21-14-4-2-1-3-5-14/h1-11H,12H2,(H,21,23) |
| InChIKey | NPKBDNPGDSSKBH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |