C21H21N3O3S — CID 7246389
N-(2-ethylphenyl)-2-[4-(4-methoxyphenyl)-3-oxopyrazin-2-yl]sulfanylacetamide (PubChem CID 7246389) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[4-(4-methoxyphenyl)-3-oxopyrazin-2-yl]sulfanylacetamide.
| Compound Name | N-(2-ethylphenyl)-2-[4-(4-methoxyphenyl)-3-oxopyrazin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 7246389 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-(2-ethylphenyl)-2-[4-(4-methoxyphenyl)-3-oxopyrazin-2-yl]sulfanylacetamide |
| SMILES | CCc1ccccc1NC(=O)CSc1nccn(-c2ccc(OC)cc2)c1=O |
| InChI | InChI=1S/C21H21N3O3S/c1-3-15-6-4-5-7-18(15)23-19(25)14-28-20-21(26)24(13-12-22-20)16-8-10-17(27-2)11-9-16/h4-13H,3,14H2,1-2H3,(H,23,25) |
| InChIKey | AQMFIBYPQNSPHU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |