C12H11ClN4O3 — CID 63801302
2-(5-amino-2,4-dioxopyrimidin-1-yl)-N-(3-chlorophenyl)acetamide (PubChem CID 63801302) has the molecular formula C12H11ClN4O3 and a molecular weight of 294.70 g/mol. Its IUPAC name is 2-(5-amino-2,4-dioxopyrimidin-1-yl)-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-(5-amino-2,4-dioxopyrimidin-1-yl)-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 63801302 |
| Molecular Formula | C12H11ClN4O3 |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-(5-amino-2,4-dioxopyrimidin-1-yl)-N-(3-chlorophenyl)acetamide |
| SMILES | Nc1cn(CC(=O)Nc2cccc(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H11ClN4O3/c13-7-2-1-3-8(4-7)15-10(18)6-17-5-9(14)11(19)16-12(17)20/h1-5H,6,14H2,(H,15,18)(H,16,19,20) |
| InChIKey | XWAIPYVXSWEGJF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |