C20H23ClN2O2 — CID 118569587
N'-(3-chlorophenyl)-N-hydroxy-2-(1-hydroxy-4-phenylcyclohexyl)ethanimidamide (PubChem CID 118569587) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is N'-(3-chlorophenyl)-N-hydroxy-2-(1-hydroxy-4-phenylcyclohexyl)ethanimidamide.
| Compound Name | N'-(3-chlorophenyl)-N-hydroxy-2-(1-hydroxy-4-phenylcyclohexyl)ethanimidamide |
|---|---|
| PubChem CID | 118569587 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N'-(3-chlorophenyl)-N-hydroxy-2-(1-hydroxy-4-phenylcyclohexyl)ethanimidamide |
| SMILES | ON/C(CC1(O)CCC(c2ccccc2)CC1)=N\c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H23ClN2O2/c21-17-7-4-8-18(13-17)22-19(23-25)14-20(24)11-9-16(10-12-20)15-5-2-1-3-6-15/h1-8,13,16,24-25H,9-12,14H2,(H,22,23) |
| InChIKey | MCDUSELJMOCUJF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|