C6H13N3O4S-2 — CID 19705071
piperidine-1-carboximidamide sulfate (PubChem CID 19705071) has the molecular formula C6H13N3O4S-2 and a molecular weight of 223.25 g/mol. Its IUPAC name is piperidine-1-carboximidamide sulfate.
| Compound Name | piperidine-1-carboximidamide sulfate |
|---|---|
| PubChem CID | 19705071 |
| Molecular Formula | C6H13N3O4S-2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | piperidine-1-carboximidamide sulfate |
| SMILES | O=S(=O)([O-])[O-].[H]/N=C(\N)N1CCCCC1 |
| InChI | InChI=1S/C6H13N3.H2O4S/c7-6(8)9-4-2-1-3-5-9;1-5(2,3)4/h1-5H2,(H3,7,8);(H2,1,2,3,4)/p-2 |
| InChIKey | QRJOPHMQLSWTEK-UHFFFAOYSA-L |
| XLogP | -0.97 |
| TPSA | 133.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|