C25H41N5O3S — CID 157437205
1-cyclohexyl-4-methylsulfonylbenzene;4-(1-methylpiperidine-4-carbonyl)piperazine-1-carboximidamide (PubChem CID 157437205) has the molecular formula C25H41N5O3S and a molecular weight of 491.70 g/mol. Its IUPAC name is 1-cyclohexyl-4-methylsulfonylbenzene;4-(1-methylpiperidine-4-carbonyl)piperazine-1-carboximidamide.
| Compound Name | 1-cyclohexyl-4-methylsulfonylbenzene;4-(1-methylpiperidine-4-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 157437205 |
| Molecular Formula | C25H41N5O3S |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 1-cyclohexyl-4-methylsulfonylbenzene;4-(1-methylpiperidine-4-carbonyl)piperazine-1-carboximidamide |
| SMILES | CS(=O)(=O)c1ccc(C2CCCCC2)cc1.[H]/N=C(\N)N1CCN(C(=O)C2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C13H18O2S.C12H23N5O/c1-16(14,15)13-9-7-12(8-10-13)11-5-3-2-4-6-11;1-15-4-2-10(3-5-15)11(18)16-6-8-17(9-7-16)12(13)14/h7-11H,2-6H2,1H3;10H,2-9H2,1H3,(H3,13,14) |
| InChIKey | BRGBSXMAYBFYJO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|