C24H39N3O3S — CID 158080260
1-cyclohexyl-4-methylsulfonylbenzene;(1-methylpiperidin-4-yl)-piperazin-1-ylmethanone (PubChem CID 158080260) has the molecular formula C24H39N3O3S and a molecular weight of 449.66 g/mol. Its IUPAC name is 1-cyclohexyl-4-methylsulfonylbenzene;(1-methylpiperidin-4-yl)-piperazin-1-ylmethanone.
| Compound Name | 1-cyclohexyl-4-methylsulfonylbenzene;(1-methylpiperidin-4-yl)-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 158080260 |
| Molecular Formula | C24H39N3O3S |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 1-cyclohexyl-4-methylsulfonylbenzene;(1-methylpiperidin-4-yl)-piperazin-1-ylmethanone |
| SMILES | CN1CCC(C(=O)N2CCNCC2)CC1.CS(=O)(=O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C13H18O2S.C11H21N3O/c1-16(14,15)13-9-7-12(8-10-13)11-5-3-2-4-6-11;1-13-6-2-10(3-7-13)11(15)14-8-4-12-5-9-14/h7-11H,2-6H2,1H3;10,12H,2-9H2,1H3 |
| InChIKey | FMWHKDBZOFVQPP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |