C9H22N4 — CID 142313225
ethane;4-methyl-1,4-diazepane-1-carboximidamide (PubChem CID 142313225) has the molecular formula C9H22N4 and a molecular weight of 186.30 g/mol. Its IUPAC name is ethane;4-methyl-1,4-diazepane-1-carboximidamide.
| Compound Name | ethane;4-methyl-1,4-diazepane-1-carboximidamide |
|---|---|
| PubChem CID | 142313225 |
| Molecular Formula | C9H22N4 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.18 |
| IUPAC Name | ethane;4-methyl-1,4-diazepane-1-carboximidamide |
| SMILES | CC.[H]/N=C(\N)N1CCCN(C)CC1 |
| InChI | InChI=1S/C7H16N4.C2H6/c1-10-3-2-4-11(6-5-10)7(8)9;1-2/h2-6H2,1H3,(H3,8,9);1-2H3 |
| InChIKey | RRVDFPIPURMXGA-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|