C14H28ClN5 — CID 176518473
2-carbamimidoyl-1,1-dicyclohexylguanidine;hydrochloride (PubChem CID 176518473) has the molecular formula C14H28ClN5 and a molecular weight of 301.87 g/mol. Its IUPAC name is 2-carbamimidoyl-1,1-dicyclohexylguanidine;hydrochloride.
| Compound Name | 2-carbamimidoyl-1,1-dicyclohexylguanidine;hydrochloride |
|---|---|
| PubChem CID | 176518473 |
| Molecular Formula | C14H28ClN5 |
| Molecular Weight | 301.87 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 2-carbamimidoyl-1,1-dicyclohexylguanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(N)/N=C(\N)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C14H27N5.ClH/c15-13(16)18-14(17)19(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h11-12H,1-10H2,(H5,15,16,17,18);1H |
| InChIKey | CQHLKFDYLWCQES-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.87 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|