C15H23N3 — CID 62364038
1-cycloheptyl-1-methyl-2-phenylguanidine (PubChem CID 62364038) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 1-cycloheptyl-1-methyl-2-phenylguanidine.
| Compound Name | 1-cycloheptyl-1-methyl-2-phenylguanidine |
|---|---|
| PubChem CID | 62364038 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 1-cycloheptyl-1-methyl-2-phenylguanidine |
| SMILES | CN(/C(N)=N/c1ccccc1)C1CCCCCC1 |
| InChI | InChI=1S/C15H23N3/c1-18(14-11-7-2-3-8-12-14)15(16)17-13-9-5-4-6-10-13/h4-6,9-10,14H,2-3,7-8,11-12H2,1H3,(H2,16,17) |
| InChIKey | LXMWHCWDLMZSDS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|