About 1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide
1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide (PubChem CID 110029419) has the molecular formula C20H26IN3
and a molecular weight of 435.35 g/mol. Its IUPAC name is 1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide.
Molecular Properties
| Compound Name | 1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide |
| PubChem CID | 110029419 |
| Molecular Formula | C20H26IN3 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide |
| SMILES | CN(/C(N)=N/CCC(c1ccccc1)c1ccccc1)C1CC1.I |
| InChI | InChI=1S/C20H25N3.HI/c1-23(18-12-13-18)20(21)22-15-14-19(16-8-4-2-5-9-16)17-10-6-3-7-11-17;/h2-11,18-19H,12-15H2,1H3,(H2,21,22);1H |
| InChIKey | LKHIPPVLXWDQDU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide?
The IUPAC name of 1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide (CID 110029419) is 1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide.
What is the SMILES notation for 1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide?
The canonical SMILES for 1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide is CN(/C(N)=N/CCC(c1ccccc1)c1ccccc1)C1CC1.I.
What is the InChIKey of 1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide?
The InChIKey is LKHIPPVLXWDQDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3.HI/c1-23(18-12-13-18)20(21)22-15-14-19(16-8-4-2-5-9-16)17-10-6-3-7-11-17;/h2-11,18-19H,12-15H2,1H3,(H2,21,22);1H.
What are the key properties of 1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide?
1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide has a molecular weight of 435.35 g/mol, XLogP of 4.24, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide is sourced from PubChem (CID 110029419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).