C20H26IN3 — CID 110029419
1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide (PubChem CID 110029419) has the molecular formula C20H26IN3 and a molecular weight of 435.35 g/mol. Its IUPAC name is 1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110029419 |
| Molecular Formula | C20H26IN3 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 1-cyclopropyl-2-(3,3-diphenylpropyl)-1-methylguanidine;hydroiodide |
| SMILES | CN(/C(N)=N/CCC(c1ccccc1)c1ccccc1)C1CC1.I |
| InChI | InChI=1S/C20H25N3.HI/c1-23(18-12-13-18)20(21)22-15-14-19(16-8-4-2-5-9-16)17-10-6-3-7-11-17;/h2-11,18-19H,12-15H2,1H3,(H2,21,22);1H |
| InChIKey | LKHIPPVLXWDQDU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|