C14H22IN3O — CID 110030946
1-cyclopropyl-2-(2-hydroxy-3-phenylpropyl)-1-methylguanidine;hydroiodide (PubChem CID 110030946) has the molecular formula C14H22IN3O and a molecular weight of 375.25 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2-hydroxy-3-phenylpropyl)-1-methylguanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-(2-hydroxy-3-phenylpropyl)-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110030946 |
| Molecular Formula | C14H22IN3O |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 1-cyclopropyl-2-(2-hydroxy-3-phenylpropyl)-1-methylguanidine;hydroiodide |
| SMILES | CN(/C(N)=N/CC(O)Cc1ccccc1)C1CC1.I |
| InChI | InChI=1S/C14H21N3O.HI/c1-17(12-7-8-12)14(15)16-10-13(18)9-11-5-3-2-4-6-11;/h2-6,12-13,18H,7-10H2,1H3,(H2,15,16);1H |
| InChIKey | UJNXNZCHNCYUQA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|