C14H21N3O — CID 110031689
1-cyclopropyl-2-[2-hydroxy-2-(3-methylphenyl)ethyl]-1-methylguanidine (PubChem CID 110031689) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-cyclopropyl-2-[2-hydroxy-2-(3-methylphenyl)ethyl]-1-methylguanidine.
| Compound Name | 1-cyclopropyl-2-[2-hydroxy-2-(3-methylphenyl)ethyl]-1-methylguanidine |
|---|---|
| PubChem CID | 110031689 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1-cyclopropyl-2-[2-hydroxy-2-(3-methylphenyl)ethyl]-1-methylguanidine |
| SMILES | Cc1cccc(C(O)C/N=C(\N)N(C)C2CC2)c1 |
| InChI | InChI=1S/C14H21N3O/c1-10-4-3-5-11(8-10)13(18)9-16-14(15)17(2)12-6-7-12/h3-5,8,12-13,18H,6-7,9H2,1-2H3,(H2,15,16) |
| InChIKey | NWVCCYMGMMUVMK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|