C16H23F3N4 — CID 129398569
1-cyclopropyl-2-[(2R)-2-(dimethylamino)-2-[3-(trifluoromethyl)phenyl]ethyl]-1-methylguanidine (PubChem CID 129398569) has the molecular formula C16H23F3N4 and a molecular weight of 328.38 g/mol. Its IUPAC name is 1-cyclopropyl-2-[(2R)-2-(dimethylamino)-2-[3-(trifluoromethyl)phenyl]ethyl]-1-methylguanidine.
| Compound Name | 1-cyclopropyl-2-[(2R)-2-(dimethylamino)-2-[3-(trifluoromethyl)phenyl]ethyl]-1-methylguanidine |
|---|---|
| PubChem CID | 129398569 |
| Molecular Formula | C16H23F3N4 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1-cyclopropyl-2-[(2R)-2-(dimethylamino)-2-[3-(trifluoromethyl)phenyl]ethyl]-1-methylguanidine |
| SMILES | CN(/C(N)=N/C[C@@H](c1cccc(C(F)(F)F)c1)N(C)C)C1CC1 |
| InChI | InChI=1S/C16H23F3N4/c1-22(2)14(10-21-15(20)23(3)13-7-8-13)11-5-4-6-12(9-11)16(17,18)19/h4-6,9,13-14H,7-8,10H2,1-3H3,(H2,20,21)/t14-/m0/s1 |
| InChIKey | XXSSFUNMJPMGSW-AWEZNQCLSA-N |
| XLogP | 2.72 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|