C16H22F3N3 — CID 110030930
1-cyclopropyl-1-methyl-2-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]guanidine (PubChem CID 110030930) has the molecular formula C16H22F3N3 and a molecular weight of 313.37 g/mol. Its IUPAC name is 1-cyclopropyl-1-methyl-2-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]guanidine.
| Compound Name | 1-cyclopropyl-1-methyl-2-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]guanidine |
|---|---|
| PubChem CID | 110030930 |
| Molecular Formula | C16H22F3N3 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-cyclopropyl-1-methyl-2-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]guanidine |
| SMILES | CN(/C(N)=N/CC(C)(C)c1cccc(C(F)(F)F)c1)C1CC1 |
| InChI | InChI=1S/C16H22F3N3/c1-15(2,10-21-14(20)22(3)13-7-8-13)11-5-4-6-12(9-11)16(17,18)19/h4-6,9,13H,7-8,10H2,1-3H3,(H2,20,21) |
| InChIKey | LZNVAGIYOQTEMP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|